C17H23FN2O4 — CID 153400231
tert-butyl 2-[(3-fluoro-4-methylphenyl)carbamoyl]morpholine-4-carboxylate (PubChem CID 153400231) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is tert-butyl 2-[(3-fluoro-4-methylphenyl)carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(3-fluoro-4-methylphenyl)carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 153400231 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl 2-[(3-fluoro-4-methylphenyl)carbamoyl]morpholine-4-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CN(C(=O)OC(C)(C)C)CCO2)cc1F |
| InChI | InChI=1S/C17H23FN2O4/c1-11-5-6-12(9-13(11)18)19-15(21)14-10-20(7-8-23-14)16(22)24-17(2,3)4/h5-6,9,14H,7-8,10H2,1-4H3,(H,19,21) |
| InChIKey | JCBWENXERWLYEC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |