C15H18ClFN2O4 — CID 118173490
tert-butyl (2R)-2-(2-chloro-3-fluoropyridine-4-carbonyl)morpholine-4-carboxylate (PubChem CID 118173490) has the molecular formula C15H18ClFN2O4 and a molecular weight of 344.77 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-chloro-3-fluoropyridine-4-carbonyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-(2-chloro-3-fluoropyridine-4-carbonyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 118173490 |
| Molecular Formula | C15H18ClFN2O4 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | tert-butyl (2R)-2-(2-chloro-3-fluoropyridine-4-carbonyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C(=O)c2ccnc(Cl)c2F)C1 |
| InChI | InChI=1S/C15H18ClFN2O4/c1-15(2,3)23-14(21)19-6-7-22-10(8-19)12(20)9-4-5-18-13(16)11(9)17/h4-5,10H,6-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | XZVPXGNHWJZPCM-SNVBAGLBSA-N |
| XLogP | 2.69 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|