C10H16LiNO5 — CID 134859282
lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate (PubChem CID 134859282) has the molecular formula C10H16LiNO5 and a molecular weight of 237.18 g/mol. Its IUPAC name is lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate.
| Compound Name | lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 134859282 |
| Molecular Formula | C10H16LiNO5 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C(=O)[O-])C1.[Li+] |
| InChI | InChI=1S/C10H17NO5.Li/c1-10(2,3)16-9(14)11-4-5-15-7(6-11)8(12)13;/h7H,4-6H2,1-3H3,(H,12,13);/q;+1/p-1/t7-;/m1./s1 |
| InChIKey | USNLTWWHSGFIIE-OGFXRTJISA-M |
| XLogP | -3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |