C13H23NO6S — CID 87947258
tert-butyl (2S)-2-[(E)-3-methylsulfonyloxyprop-1-enyl]morpholine-4-carboxylate (PubChem CID 87947258) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-3-methylsulfonyloxyprop-1-enyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-3-methylsulfonyloxyprop-1-enyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87947258 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-3-methylsulfonyloxyprop-1-enyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](/C=C/COS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H23NO6S/c1-13(2,3)20-12(15)14-7-9-18-11(10-14)6-5-8-19-21(4,16)17/h5-6,11H,7-10H2,1-4H3/b6-5+/t11-/m0/s1 |
| InChIKey | BJGKRKXJYWONMM-QRGHLMKCSA-N |
| XLogP | 1.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|