C14H25NO5S — CID 58525460
tert-butyl (2S,3S)-3-methyl-2-[(E)-3-methylsulfonyloxyprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 58525460) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-methyl-2-[(E)-3-methylsulfonyloxyprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-methyl-2-[(E)-3-methylsulfonyloxyprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58525460 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl (2S,3S)-3-methyl-2-[(E)-3-methylsulfonyloxyprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1/C=C/COS(C)(=O)=O |
| InChI | InChI=1S/C14H25NO5S/c1-11-8-9-15(13(16)20-14(2,3)4)12(11)7-6-10-19-21(5,17)18/h6-7,11-12H,8-10H2,1-5H3/b7-6+/t11-,12+/m0/s1 |
| InChIKey | DFAXJCGVOCIGIQ-FNSAGKMKSA-N |
| XLogP | 2.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|