C18H25Cl2NO6S — CID 86663875
tert-butyl 6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylate (PubChem CID 86663875) has the molecular formula C18H25Cl2NO6S and a molecular weight of 454.37 g/mol. Its IUPAC name is tert-butyl 6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 86663875 |
| Molecular Formula | C18H25Cl2NO6S |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | tert-butyl 6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(COS(C)(=O)=O)C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H25Cl2NO6S/c1-18(2,3)27-17(22)21-7-8-25-16(11-26-28(4,23)24)13(10-21)12-5-6-14(19)15(20)9-12/h5-6,9,13,16H,7-8,10-11H2,1-4H3 |
| InChIKey | KHTNESDVSIDIRS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|