C21H27Cl2NO4 — CID 66976741
tert-butyl (6R,7R)-6-(3,4-dichlorophenyl)-7-(3-hydroxypenta-1,4-dien-3-yl)-1,4-oxazepane-4-carboxylate (PubChem CID 66976741) has the molecular formula C21H27Cl2NO4 and a molecular weight of 428.36 g/mol. Its IUPAC name is tert-butyl (6R,7R)-6-(3,4-dichlorophenyl)-7-(3-hydroxypenta-1,4-dien-3-yl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6R,7R)-6-(3,4-dichlorophenyl)-7-(3-hydroxypenta-1,4-dien-3-yl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66976741 |
| Molecular Formula | C21H27Cl2NO4 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | tert-butyl (6R,7R)-6-(3,4-dichlorophenyl)-7-(3-hydroxypenta-1,4-dien-3-yl)-1,4-oxazepane-4-carboxylate |
| SMILES | C=CC(O)(C=C)[C@@H]1OCCN(C(=O)OC(C)(C)C)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H27Cl2NO4/c1-6-21(26,7-2)18-15(14-8-9-16(22)17(23)12-14)13-24(10-11-27-18)19(25)28-20(3,4)5/h6-9,12,15,18,26H,1-2,10-11,13H2,3-5H3/t15-,18+/m0/s1 |
| InChIKey | KATJGDKGMJNJOX-MAUKXSAKSA-N |
| XLogP | 4.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|