C19H25Cl2NO4S — CID 86663876
tert-butyl (6R,7S)-7-(acetylsulfanylmethyl)-6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate (PubChem CID 86663876) has the molecular formula C19H25Cl2NO4S and a molecular weight of 434.39 g/mol. Its IUPAC name is tert-butyl (6R,7S)-7-(acetylsulfanylmethyl)-6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6R,7S)-7-(acetylsulfanylmethyl)-6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 86663876 |
| Molecular Formula | C19H25Cl2NO4S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | tert-butyl (6R,7S)-7-(acetylsulfanylmethyl)-6-(3,4-dichlorophenyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(=O)SC[C@H]1OCCN(C(=O)OC(C)(C)C)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H25Cl2NO4S/c1-12(23)27-11-17-14(13-5-6-15(20)16(21)9-13)10-22(7-8-25-17)18(24)26-19(2,3)4/h5-6,9,14,17H,7-8,10-11H2,1-4H3/t14-,17+/m0/s1 |
| InChIKey | ATUGJAZJYDVLIB-WMLDXEAASA-N |
| XLogP | 4.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|