C18H25Cl2NO6S — CID 87222385
(6R,7R)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid (PubChem CID 87222385) has the molecular formula C18H25Cl2NO6S and a molecular weight of 454.37 g/mol. Its IUPAC name is (6R,7R)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid.
| Compound Name | (6R,7R)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 87222385 |
| Molecular Formula | C18H25Cl2NO6S |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (6R,7R)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)C[C@@H](c2ccc(Cl)c(Cl)c2)[C@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C18H25Cl2NO6S/c1-18(2,3)16-9-21(17(22)23)8-12(11-5-6-13(19)14(20)7-11)15(27-16)10-26-28(4,24)25/h5-7,12,15-16H,8-10H2,1-4H3,(H,22,23)/t12-,15-,16?/m0/s1 |
| InChIKey | SMXNTRHKDJVKTD-MUWBKCKESA-N |
| XLogP | 3.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|