C21H39N5O9S — CID 159322786
tert-butyl 2-(azidomethyl)morpholine-4-carboxylate;tert-butyl 2-(methylsulfonyloxymethyl)morpholine-4-carboxylate (PubChem CID 159322786) has the molecular formula C21H39N5O9S and a molecular weight of 537.64 g/mol. Its IUPAC name is tert-butyl 2-(azidomethyl)morpholine-4-carboxylate;tert-butyl 2-(methylsulfonyloxymethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(azidomethyl)morpholine-4-carboxylate;tert-butyl 2-(methylsulfonyloxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 159322786 |
| Molecular Formula | C21H39N5O9S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | tert-butyl 2-(azidomethyl)morpholine-4-carboxylate;tert-butyl 2-(methylsulfonyloxymethyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(CN=[N+]=[N-])C1.CC(C)(C)OC(=O)N1CCOC(COS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21NO6S.C10H18N4O3/c1-11(2,3)18-10(13)12-5-6-16-9(7-12)8-17-19(4,14)15;1-10(2,3)17-9(15)14-4-5-16-8(7-14)6-12-13-11/h9H,5-8H2,1-4H3;8H,4-7H2,1-3H3 |
| InChIKey | LDZAMNOJAWDOQQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 169.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|