C35H63N5O7S — CID 161480996
tert-butyl 4-(azidomethyl)-4-cyclohexylpiperidine-1-carboxylate;tert-butyl 4-cyclohexyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 161480996) has the molecular formula C35H63N5O7S and a molecular weight of 697.98 g/mol. Its IUPAC name is tert-butyl 4-(azidomethyl)-4-cyclohexylpiperidine-1-carboxylate;tert-butyl 4-cyclohexyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(azidomethyl)-4-cyclohexylpiperidine-1-carboxylate;tert-butyl 4-cyclohexyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161480996 |
| Molecular Formula | C35H63N5O7S |
| Molecular Weight | 697.98 g/mol |
| Exact Mass | 697.44 |
| IUPAC Name | tert-butyl 4-(azidomethyl)-4-cyclohexylpiperidine-1-carboxylate;tert-butyl 4-cyclohexyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN=[N+]=[N-])(C2CCCCC2)CC1.CC(C)(C)OC(=O)N1CCC(COS(C)(=O)=O)(C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H33NO5S.C17H30N4O2/c1-17(2,3)24-16(20)19-12-10-18(11-13-19,14-23-25(4,21)22)15-8-6-5-7-9-15;1-16(2,3)23-15(22)21-11-9-17(10-12-21,13-19-20-18)14-7-5-4-6-8-14/h15H,5-14H2,1-4H3;14H,4-13H2,1-3H3 |
| InChIKey | WEISVYPSZTZLRV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 151.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.98 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|