C21H37NO4 — CID 58602432
tert-butyl 4-cyclohexyl-4-(3-ethoxy-3-oxopropyl)piperidine-1-carboxylate (PubChem CID 58602432) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl 4-cyclohexyl-4-(3-ethoxy-3-oxopropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyclohexyl-4-(3-ethoxy-3-oxopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58602432 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | tert-butyl 4-cyclohexyl-4-(3-ethoxy-3-oxopropyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CCC1(C2CCCCC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H37NO4/c1-5-25-18(23)11-12-21(17-9-7-6-8-10-17)13-15-22(16-14-21)19(24)26-20(2,3)4/h17H,5-16H2,1-4H3 |
| InChIKey | GNIYZCPPSWYEMZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |