C20H32N2O4 — CID 140729074
tert-butyl 4-cyclopentyl-4-(2-ethoxy-1-isocyano-2-oxoethyl)piperidine-1-carboxylate (PubChem CID 140729074) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl 4-cyclopentyl-4-(2-ethoxy-1-isocyano-2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyclopentyl-4-(2-ethoxy-1-isocyano-2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140729074 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl 4-cyclopentyl-4-(2-ethoxy-1-isocyano-2-oxoethyl)piperidine-1-carboxylate |
| SMILES | [C-]#[N+]C(C(=O)OCC)C1(C2CCCC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H32N2O4/c1-6-25-17(23)16(21-5)20(15-9-7-8-10-15)11-13-22(14-12-20)18(24)26-19(2,3)4/h15-16H,6-14H2,1-4H3 |
| InChIKey | HISNYWROOVKTQY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|