C21H37ClN2O3 — CID 21018694
tert-butyl 4-[(4-chlorobutanoylamino)methyl]-4-cyclohexylpiperidine-1-carboxylate (PubChem CID 21018694) has the molecular formula C21H37ClN2O3 and a molecular weight of 400.99 g/mol. Its IUPAC name is tert-butyl 4-[(4-chlorobutanoylamino)methyl]-4-cyclohexylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-chlorobutanoylamino)methyl]-4-cyclohexylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 21018694 |
| Molecular Formula | C21H37ClN2O3 |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl 4-[(4-chlorobutanoylamino)methyl]-4-cyclohexylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)CCCCl)(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H37ClN2O3/c1-20(2,3)27-19(26)24-14-11-21(12-15-24,17-8-5-4-6-9-17)16-23-18(25)10-7-13-22/h17H,4-16H2,1-3H3,(H,23,25) |
| InChIKey | XJWXOEJMMJKYSC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|