C19H35NO3 — CID 103916009
tert-butyl 4-(cyclohexylmethoxy)-4-ethylpiperidine-1-carboxylate (PubChem CID 103916009) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl 4-(cyclohexylmethoxy)-4-ethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(cyclohexylmethoxy)-4-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 103916009 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tert-butyl 4-(cyclohexylmethoxy)-4-ethylpiperidine-1-carboxylate |
| SMILES | CCC1(OCC2CCCCC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H35NO3/c1-5-19(22-15-16-9-7-6-8-10-16)11-13-20(14-12-19)17(21)23-18(2,3)4/h16H,5-15H2,1-4H3 |
| InChIKey | JDLXDJCXQVGSKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |