C17H31NO3 — CID 83207659
tert-butyl 4-(cyclopentylmethoxy)-4-methylpiperidine-1-carboxylate (PubChem CID 83207659) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is tert-butyl 4-(cyclopentylmethoxy)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(cyclopentylmethoxy)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 83207659 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | tert-butyl 4-(cyclopentylmethoxy)-4-methylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(OCC2CCCC2)CC1 |
| InChI | InChI=1S/C17H31NO3/c1-16(2,3)21-15(19)18-11-9-17(4,10-12-18)20-13-14-7-5-6-8-14/h14H,5-13H2,1-4H3 |
| InChIKey | AWKWZZNBCUSCJH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |