C15H29NO5 — CID 83206348
tert-butyl 4-(2,2-dimethoxyethoxy)-4-methylpiperidine-1-carboxylate (PubChem CID 83206348) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethoxyethoxy)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,2-dimethoxyethoxy)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 83206348 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | tert-butyl 4-(2,2-dimethoxyethoxy)-4-methylpiperidine-1-carboxylate |
| SMILES | COC(COC1(C)CCN(C(=O)OC(C)(C)C)CC1)OC |
| InChI | InChI=1S/C15H29NO5/c1-14(2,3)21-13(17)16-9-7-15(4,8-10-16)20-11-12(18-5)19-6/h12H,7-11H2,1-6H3 |
| InChIKey | LHUIROYYNANQGG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|