C16H28F3NO3 — CID 103916044
tert-butyl 4-ethyl-4-(4,4,4-trifluorobutoxy)piperidine-1-carboxylate (PubChem CID 103916044) has the molecular formula C16H28F3NO3 and a molecular weight of 339.40 g/mol. Its IUPAC name is tert-butyl 4-ethyl-4-(4,4,4-trifluorobutoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-ethyl-4-(4,4,4-trifluorobutoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103916044 |
| Molecular Formula | C16H28F3NO3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl 4-ethyl-4-(4,4,4-trifluorobutoxy)piperidine-1-carboxylate |
| SMILES | CCC1(OCCCC(F)(F)F)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28F3NO3/c1-5-15(22-12-6-7-16(17,18)19)8-10-20(11-9-15)13(21)23-14(2,3)4/h5-12H2,1-4H3 |
| InChIKey | MRRHVTOSEBJAED-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|