C14H24F3NO4 — CID 106938793
tert-butyl 3-ethyl-3-(2,2,2-trifluoroethoxymethoxy)pyrrolidine-1-carboxylate (PubChem CID 106938793) has the molecular formula C14H24F3NO4 and a molecular weight of 327.34 g/mol. Its IUPAC name is tert-butyl 3-ethyl-3-(2,2,2-trifluoroethoxymethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-3-(2,2,2-trifluoroethoxymethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106938793 |
| Molecular Formula | C14H24F3NO4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | tert-butyl 3-ethyl-3-(2,2,2-trifluoroethoxymethoxy)pyrrolidine-1-carboxylate |
| SMILES | CCC1(OCOCC(F)(F)F)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H24F3NO4/c1-5-13(21-10-20-9-14(15,16)17)6-7-18(8-13)11(19)22-12(2,3)4/h5-10H2,1-4H3 |
| InChIKey | WWSYBGWYKPMBNS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|