C15H26ClNO3 — CID 106439139
tert-butyl 3-(3-chloro-2-methylprop-2-enoxy)-3-ethylpyrrolidine-1-carboxylate (PubChem CID 106439139) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is tert-butyl 3-(3-chloro-2-methylprop-2-enoxy)-3-ethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-chloro-2-methylprop-2-enoxy)-3-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106439139 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl 3-(3-chloro-2-methylprop-2-enoxy)-3-ethylpyrrolidine-1-carboxylate |
| SMILES | CCC1(OCC(C)=CCl)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H26ClNO3/c1-6-15(19-10-12(2)9-16)7-8-17(11-15)13(18)20-14(3,4)5/h9H,6-8,10-11H2,1-5H3 |
| InChIKey | FMFUBDJBDFGLFE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |