C18H33NO3 — CID 107007740
tert-butyl 3-ethyl-3-hept-6-enoxypyrrolidine-1-carboxylate (PubChem CID 107007740) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl 3-ethyl-3-hept-6-enoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-3-hept-6-enoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107007740 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | tert-butyl 3-ethyl-3-hept-6-enoxypyrrolidine-1-carboxylate |
| SMILES | C=CCCCCCOC1(CC)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H33NO3/c1-6-8-9-10-11-14-21-18(7-2)12-13-19(15-18)16(20)22-17(3,4)5/h6H,1,7-15H2,2-5H3 |
| InChIKey | IBWKSVUHGDWVIY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|