C17H33NO5 — CID 103916089
tert-butyl 3-(2,2-diethoxyethoxy)-3-ethylpyrrolidine-1-carboxylate (PubChem CID 103916089) has the molecular formula C17H33NO5 and a molecular weight of 331.45 g/mol. Its IUPAC name is tert-butyl 3-(2,2-diethoxyethoxy)-3-ethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,2-diethoxyethoxy)-3-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103916089 |
| Molecular Formula | C17H33NO5 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | tert-butyl 3-(2,2-diethoxyethoxy)-3-ethylpyrrolidine-1-carboxylate |
| SMILES | CCOC(COC1(CC)CCN(C(=O)OC(C)(C)C)C1)OCC |
| InChI | InChI=1S/C17H33NO5/c1-7-17(22-12-14(20-8-2)21-9-3)10-11-18(13-17)15(19)23-16(4,5)6/h14H,7-13H2,1-6H3 |
| InChIKey | ZOMPTNSIWXAZID-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|