C17H29N3O3 — CID 106938800
tert-butyl 3-ethyl-3-[(1-ethylimidazol-2-yl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 106938800) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 3-ethyl-3-[(1-ethylimidazol-2-yl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-3-[(1-ethylimidazol-2-yl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106938800 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl 3-ethyl-3-[(1-ethylimidazol-2-yl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | CCn1ccnc1COC1(CC)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H29N3O3/c1-6-17(22-12-14-18-9-11-19(14)7-2)8-10-20(13-17)15(21)23-16(3,4)5/h9,11H,6-8,10,12-13H2,1-5H3 |
| InChIKey | AJDRDMCEOKZZNI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |