C15H27NO3 — CID 83206245
tert-butyl 3-ethyl-3-(2-methylprop-2-enoxy)pyrrolidine-1-carboxylate (PubChem CID 83206245) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl 3-ethyl-3-(2-methylprop-2-enoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-ethyl-3-(2-methylprop-2-enoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 83206245 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl 3-ethyl-3-(2-methylprop-2-enoxy)pyrrolidine-1-carboxylate |
| SMILES | C=C(C)COC1(CC)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27NO3/c1-7-15(18-10-12(2)3)8-9-16(11-15)13(17)19-14(4,5)6/h2,7-11H2,1,3-6H3 |
| InChIKey | IZFUFQKAGTUQSK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|