C12H20F2N4O2 — CID 178190091
tert-butyl 4-(azidomethyl)-4-(difluoromethyl)piperidine-1-carboxylate (PubChem CID 178190091) has the molecular formula C12H20F2N4O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is tert-butyl 4-(azidomethyl)-4-(difluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(azidomethyl)-4-(difluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178190091 |
| Molecular Formula | C12H20F2N4O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl 4-(azidomethyl)-4-(difluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN=[N+]=[N-])(C(F)F)CC1 |
| InChI | InChI=1S/C12H20F2N4O2/c1-11(2,3)20-10(19)18-6-4-12(5-7-18,9(13)14)8-16-17-15/h9H,4-8H2,1-3H3 |
| InChIKey | VIRVLTJWUOBPNT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|