C13H24F2N2O2 — CID 103512878
tert-butyl 3-(difluoromethyl)-3-(methylaminomethyl)piperidine-1-carboxylate (PubChem CID 103512878) has the molecular formula C13H24F2N2O2 and a molecular weight of 278.34 g/mol. Its IUPAC name is tert-butyl 3-(difluoromethyl)-3-(methylaminomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(difluoromethyl)-3-(methylaminomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103512878 |
| Molecular Formula | C13H24F2N2O2 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | tert-butyl 3-(difluoromethyl)-3-(methylaminomethyl)piperidine-1-carboxylate |
| SMILES | CNCC1(C(F)F)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H24F2N2O2/c1-12(2,3)19-11(18)17-7-5-6-13(9-17,8-16-4)10(14)15/h10,16H,5-9H2,1-4H3 |
| InChIKey | ABJRUOMWGVMPSB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |