C13H25NO3 — CID 129395641
tert-butyl (3R)-3-(methoxymethyl)-3-methylpiperidine-1-carboxylate (PubChem CID 129395641) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl (3R)-3-(methoxymethyl)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(methoxymethyl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129395641 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl (3R)-3-(methoxymethyl)-3-methylpiperidine-1-carboxylate |
| SMILES | COC[C@]1(C)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H25NO3/c1-12(2,3)17-11(15)14-8-6-7-13(4,9-14)10-16-5/h6-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | VTYTZECPQVSIHB-CYBMUJFWSA-N |
| XLogP | 2.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |