C15H31N3O2 — CID 107254670
tert-butyl 3-[(3-aminopropylamino)methyl]-3-methylpiperidine-1-carboxylate (PubChem CID 107254670) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl 3-[(3-aminopropylamino)methyl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-aminopropylamino)methyl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 107254670 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | tert-butyl 3-[(3-aminopropylamino)methyl]-3-methylpiperidine-1-carboxylate |
| SMILES | CC1(CNCCCN)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-14(2,3)20-13(19)18-10-5-7-15(4,12-18)11-17-9-6-8-16/h17H,5-12,16H2,1-4H3 |
| InChIKey | CDHGUXJHMYXANE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|