C17H27IN2O3 — CID 107254655
tert-butyl 3-[[(5-iodofuran-2-yl)methylamino]methyl]-3-methylpiperidine-1-carboxylate (PubChem CID 107254655) has the molecular formula C17H27IN2O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is tert-butyl 3-[[(5-iodofuran-2-yl)methylamino]methyl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(5-iodofuran-2-yl)methylamino]methyl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 107254655 |
| Molecular Formula | C17H27IN2O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | tert-butyl 3-[[(5-iodofuran-2-yl)methylamino]methyl]-3-methylpiperidine-1-carboxylate |
| SMILES | CC1(CNCc2ccc(I)o2)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H27IN2O3/c1-16(2,3)23-15(21)20-9-5-8-17(4,12-20)11-19-10-13-6-7-14(18)22-13/h6-7,19H,5,8-12H2,1-4H3 |
| InChIKey | JQJQLYPFTSGWEC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|