C14H19N3O4 — CID 178068955
tert-butyl 2-(2,2-dicyano-1-methoxyethenyl)morpholine-4-carboxylate (PubChem CID 178068955) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dicyano-1-methoxyethenyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(2,2-dicyano-1-methoxyethenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 178068955 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl 2-(2,2-dicyano-1-methoxyethenyl)morpholine-4-carboxylate |
| SMILES | COC(=C(C#N)C#N)C1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C14H19N3O4/c1-14(2,3)21-13(18)17-5-6-20-11(9-17)12(19-4)10(7-15)8-16/h11H,5-6,9H2,1-4H3 |
| InChIKey | RBOSJKBCTNESAB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|