C15H21N3O3 — CID 93481128
tert-butyl (3S)-3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylate (PubChem CID 93481128) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 93481128 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl (3S)-3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylate |
| SMILES | COC(=C(C#N)C#N)[C@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-15(2,3)21-14(19)18-7-5-6-11(10-18)13(20-4)12(8-16)9-17/h11H,5-7,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | ACICDBSAKSTXJP-NSHDSACASA-N |
| XLogP | 2.58 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|