C11H13N3O3 — CID 87886377
3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylic acid (PubChem CID 87886377) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylic acid.
| Compound Name | 3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87886377 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-(2,2-dicyano-1-methoxyethenyl)piperidine-1-carboxylic acid |
| SMILES | COC(=C(C#N)C#N)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C11H13N3O3/c1-17-10(9(5-12)6-13)8-3-2-4-14(7-8)11(15)16/h8H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | ZFVXQCJYVRLRHW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|