C12H21KN2O3 — CID 142544940
potassium methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carbonyl]azanide (PubChem CID 142544940) has the molecular formula C12H21KN2O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is potassium methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carbonyl]azanide.
| Compound Name | potassium methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carbonyl]azanide |
|---|---|
| PubChem CID | 142544940 |
| Molecular Formula | C12H21KN2O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | potassium methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carbonyl]azanide |
| SMILES | C[N-]C(=O)C1CCCN(C(=O)OC(C)(C)C)C1.[K+] |
| InChI | InChI=1S/C12H22N2O3.K/c1-12(2,3)17-11(16)14-7-5-6-9(8-14)10(15)13-4;/h9H,5-8H2,1-4H3,(H,13,15);/q;+1/p-1 |
| InChIKey | GHGLNBBWMPHUKT-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |