C14H23NO5 — CID 162741113
tert-butyl 2-(2-ethoxyprop-2-enoyl)morpholine-4-carboxylate (PubChem CID 162741113) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl 2-(2-ethoxyprop-2-enoyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(2-ethoxyprop-2-enoyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 162741113 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl 2-(2-ethoxyprop-2-enoyl)morpholine-4-carboxylate |
| SMILES | C=C(OCC)C(=O)C1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C14H23NO5/c1-6-18-10(2)12(16)11-9-15(7-8-19-11)13(17)20-14(3,4)5/h11H,2,6-9H2,1,3-5H3 |
| InChIKey | RPYPFZUOCOJSCB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|