About ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone
ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone (PubChem CID 142506690) has the molecular formula C21H46N2O5
and a molecular weight of 406.61 g/mol. Its IUPAC name is ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone.
Molecular Properties
| Compound Name | ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone |
| PubChem CID | 142506690 |
| Molecular Formula | C21H46N2O5 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone |
| SMILES | CC.CC.CC.CC(=O)N1CCOC(C)C1.CCOC(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C8H15NO3.C7H13NO2.3C2H6/c1-3-11-8(10)9-4-5-12-7(2)6-9;1-6-5-8(7(2)9)3-4-10-6;3*1-2/h7H,3-6H2,1-2H3;6H,3-5H2,1-2H3;3*1-2H3 |
| InChIKey | FEIVZDZEAGHECG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone?
The IUPAC name of ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone (CID 142506690) is ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone.
What is the SMILES notation for ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone?
The canonical SMILES for ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone is CC.CC.CC.CC(=O)N1CCOC(C)C1.CCOC(=O)N1CCOC(C)C1.
What is the InChIKey of ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone?
The InChIKey is FEIVZDZEAGHECG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.C7H13NO2.3C2H6/c1-3-11-8(10)9-4-5-12-7(2)6-9;1-6-5-8(7(2)9)3-4-10-6;3*1-2/h7H,3-6H2,1-2H3;6H,3-5H2,1-2H3;3*1-2H3.
What are the key properties of ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone?
ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone has a molecular weight of 406.61 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-methylmorpholine-4-carboxylate;1-(2-methylmorpholin-4-yl)ethanone is sourced from PubChem (CID 142506690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).