C20H26FN3O4 — CID 166404912
tert-butyl (2R)-2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 166404912) has the molecular formula C20H26FN3O4 and a molecular weight of 391.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166404912 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | tert-butyl (2R)-2-[[4-fluoro-3-(prop-2-enoylamino)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | C=CC(=O)Nc1cc(NC(=O)[C@H]2CCCCN2C(=O)OC(C)(C)C)ccc1F |
| InChI | InChI=1S/C20H26FN3O4/c1-5-17(25)23-15-12-13(9-10-14(15)21)22-18(26)16-8-6-7-11-24(16)19(27)28-20(2,3)4/h5,9-10,12,16H,1,6-8,11H2,2-4H3,(H,22,26)(H,23,25)/t16-/m1/s1 |
| InChIKey | HRDWDJMMSKIODF-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|