C19H20N6O4 — CID 175550903
3-methoxy-5-nitro-4-[[1-(2-phenylethyl)triazol-4-yl]methylamino]benzamide (PubChem CID 175550903) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-methoxy-5-nitro-4-[[1-(2-phenylethyl)triazol-4-yl]methylamino]benzamide.
| Compound Name | 3-methoxy-5-nitro-4-[[1-(2-phenylethyl)triazol-4-yl]methylamino]benzamide |
|---|---|
| PubChem CID | 175550903 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-methoxy-5-nitro-4-[[1-(2-phenylethyl)triazol-4-yl]methylamino]benzamide |
| SMILES | COc1cc(C(N)=O)cc([N+](=O)[O-])c1NCc1cn(CCc2ccccc2)nn1 |
| InChI | InChI=1S/C19H20N6O4/c1-29-17-10-14(19(20)26)9-16(25(27)28)18(17)21-11-15-12-24(23-22-15)8-7-13-5-3-2-4-6-13/h2-6,9-10,12,21H,7-8,11H2,1H3,(H2,20,26) |
| InChIKey | ILRGAPCTZKPVIM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|