C12H15N5O4 — CID 66270181
2-[4-[(4-methoxy-2-nitroanilino)methyl]triazol-1-yl]ethanol (PubChem CID 66270181) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-[4-[(4-methoxy-2-nitroanilino)methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[(4-methoxy-2-nitroanilino)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66270181 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[4-[(4-methoxy-2-nitroanilino)methyl]triazol-1-yl]ethanol |
| SMILES | COc1ccc(NCc2cn(CCO)nn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N5O4/c1-21-10-2-3-11(12(6-10)17(19)20)13-7-9-8-16(4-5-18)15-14-9/h2-3,6,8,13,18H,4-5,7H2,1H3 |
| InChIKey | SXPWMEMGUQFFRV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|