C12H12N6O3 — CID 66268672
2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-5-nitrobenzonitrile (PubChem CID 66268672) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 66268672 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NCc1cn(CCO)nn1 |
| InChI | InChI=1S/C12H12N6O3/c13-6-9-5-11(18(20)21)1-2-12(9)14-7-10-8-17(3-4-19)16-15-10/h1-2,5,8,14,19H,3-4,7H2 |
| InChIKey | JBMZGYVDWZTPLM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|