C12H14BrN5O3 — CID 66269125
3-[4-[(4-bromo-2-nitroanilino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66269125) has the molecular formula C12H14BrN5O3 and a molecular weight of 356.18 g/mol. Its IUPAC name is 3-[4-[(4-bromo-2-nitroanilino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(4-bromo-2-nitroanilino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66269125 |
| Molecular Formula | C12H14BrN5O3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-[4-[(4-bromo-2-nitroanilino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1NCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C12H14BrN5O3/c13-9-2-3-11(12(6-9)18(20)21)14-7-10-8-17(16-15-10)4-1-5-19/h2-3,6,8,14,19H,1,4-5,7H2 |
| InChIKey | VGBFNEODXXQICX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|