C12H14ClIN4O — CID 66270447
3-[4-[(2-chloro-4-iodoanilino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66270447) has the molecular formula C12H14ClIN4O and a molecular weight of 392.63 g/mol. Its IUPAC name is 3-[4-[(2-chloro-4-iodoanilino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(2-chloro-4-iodoanilino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66270447 |
| Molecular Formula | C12H14ClIN4O |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 3-[4-[(2-chloro-4-iodoanilino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNc2ccc(I)cc2Cl)nn1 |
| InChI | InChI=1S/C12H14ClIN4O/c13-11-6-9(14)2-3-12(11)15-7-10-8-18(17-16-10)4-1-5-19/h2-3,6,8,15,19H,1,4-5,7H2 |
| InChIKey | WSSJXFMWPJGNFU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|