C12H18N4O2 — CID 144909740
3,5-diamino-4-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 144909740) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,5-diamino-4-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | 3,5-diamino-4-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 144909740 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3,5-diamino-4-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | CC(C)(C)C(=O)Nc1c(N)cc(C(N)=O)cc1N |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,3)11(18)16-9-7(13)4-6(10(15)17)5-8(9)14/h4-5H,13-14H2,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | ILIJGDWELWEUDH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|