C13H17N3O4 — CID 103028794
5-[(2-methoxy-2-methylpropanoyl)amino]benzene-1,3-dicarboxamide (PubChem CID 103028794) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-[(2-methoxy-2-methylpropanoyl)amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[(2-methoxy-2-methylpropanoyl)amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 103028794 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[(2-methoxy-2-methylpropanoyl)amino]benzene-1,3-dicarboxamide |
| SMILES | COC(C)(C)C(=O)Nc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C13H17N3O4/c1-13(2,20-3)12(19)16-9-5-7(10(14)17)4-8(6-9)11(15)18/h4-6H,1-3H3,(H2,14,17)(H2,15,18)(H,16,19) |
| InChIKey | BWGNTPVXKKNHAW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |