C10H9F2N3O3 — CID 113218225
5-[(2,2-difluoroacetyl)amino]benzene-1,3-dicarboxamide (PubChem CID 113218225) has the molecular formula C10H9F2N3O3 and a molecular weight of 257.20 g/mol. Its IUPAC name is 5-[(2,2-difluoroacetyl)amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[(2,2-difluoroacetyl)amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 113218225 |
| Molecular Formula | C10H9F2N3O3 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 5-[(2,2-difluoroacetyl)amino]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NC(=O)C(F)F)cc(C(N)=O)c1 |
| InChI | InChI=1S/C10H9F2N3O3/c11-7(12)10(18)15-6-2-4(8(13)16)1-5(3-6)9(14)17/h1-3,7H,(H2,13,16)(H2,14,17)(H,15,18) |
| InChIKey | ACKSPMIVONSPRH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |