C8H7F2NO2 — CID 103600554
2,2-difluoro-N-(3-hydroxyphenyl)acetamide (PubChem CID 103600554) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is 2,2-difluoro-N-(3-hydroxyphenyl)acetamide.
| Compound Name | 2,2-difluoro-N-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 103600554 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2,2-difluoro-N-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Nc1cccc(O)c1)C(F)F |
| InChI | InChI=1S/C8H7F2NO2/c9-7(10)8(13)11-5-2-1-3-6(12)4-5/h1-4,7,12H,(H,11,13) |
| InChIKey | MRBGYIBCGNWPQW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |