C9H7F4NO — CID 165403947
N-(3,4-difluoro-5-methylphenyl)-2,2-difluoroacetamide (PubChem CID 165403947) has the molecular formula C9H7F4NO and a molecular weight of 221.15 g/mol. Its IUPAC name is N-(3,4-difluoro-5-methylphenyl)-2,2-difluoroacetamide.
| Compound Name | N-(3,4-difluoro-5-methylphenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 165403947 |
| Molecular Formula | C9H7F4NO |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | N-(3,4-difluoro-5-methylphenyl)-2,2-difluoroacetamide |
| SMILES | Cc1cc(NC(=O)C(F)F)cc(F)c1F |
| InChI | InChI=1S/C9H7F4NO/c1-4-2-5(3-6(10)7(4)11)14-9(15)8(12)13/h2-3,8H,1H3,(H,14,15) |
| InChIKey | APENDFAFNVIQHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |