C14H9ClF3NO — CID 62811265
2-chloro-2-phenyl-N-(3,4,5-trifluorophenyl)acetamide (PubChem CID 62811265) has the molecular formula C14H9ClF3NO and a molecular weight of 299.68 g/mol. Its IUPAC name is 2-chloro-2-phenyl-N-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-chloro-2-phenyl-N-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 62811265 |
| Molecular Formula | C14H9ClF3NO |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-chloro-2-phenyl-N-(3,4,5-trifluorophenyl)acetamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H9ClF3NO/c15-12(8-4-2-1-3-5-8)14(20)19-9-6-10(16)13(18)11(17)7-9/h1-7,12H,(H,19,20) |
| InChIKey | IMPLQUIKMBXXON-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|