C14H9F4NO — CID 115745629
4-fluoro-2-methyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 115745629) has the molecular formula C14H9F4NO and a molecular weight of 283.22 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-2-methyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 115745629 |
| Molecular Formula | C14H9F4NO |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-fluoro-2-methyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | Cc1cc(F)ccc1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H9F4NO/c1-7-4-8(15)2-3-10(7)14(20)19-9-5-11(16)13(18)12(17)6-9/h2-6H,1H3,(H,19,20) |
| InChIKey | NRDFPNQYZIGBPM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|