C15H13FN2O2 — CID 115745097
N-(4-carbamoylphenyl)-4-fluoro-2-methylbenzamide (PubChem CID 115745097) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-4-fluoro-2-methylbenzamide.
| Compound Name | N-(4-carbamoylphenyl)-4-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 115745097 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-(4-carbamoylphenyl)-4-fluoro-2-methylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C15H13FN2O2/c1-9-8-11(16)4-7-13(9)15(20)18-12-5-2-10(3-6-12)14(17)19/h2-8H,1H3,(H2,17,19)(H,18,20) |
| InChIKey | NQYRXFXCVGOAGB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |