C12H16N4O3 — CID 61273837
5-(4-aminobutanoylamino)benzene-1,3-dicarboxamide (PubChem CID 61273837) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-(4-aminobutanoylamino)benzene-1,3-dicarboxamide.
| Compound Name | 5-(4-aminobutanoylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 61273837 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-(4-aminobutanoylamino)benzene-1,3-dicarboxamide |
| SMILES | NCCCC(=O)Nc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C12H16N4O3/c13-3-1-2-10(17)16-9-5-7(11(14)18)4-8(6-9)12(15)19/h4-6H,1-3,13H2,(H2,14,18)(H2,15,19)(H,16,17) |
| InChIKey | ZBYRFMFPGKXWDE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |